C19H28FNO — CID 174665920
1-(2-cyclohexylethyl)-4-(4-fluorophenoxy)piperidine (PubChem CID 174665920) has the molecular formula C19H28FNO and a molecular weight of 305.44 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-4-(4-fluorophenoxy)piperidine.
| Compound Name | 1-(2-cyclohexylethyl)-4-(4-fluorophenoxy)piperidine |
|---|---|
| PubChem CID | 174665920 |
| Molecular Formula | C19H28FNO |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 1-(2-cyclohexylethyl)-4-(4-fluorophenoxy)piperidine |
| SMILES | Fc1ccc(OC2CCN(CCC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C19H28FNO/c20-17-6-8-18(9-7-17)22-19-11-14-21(15-12-19)13-10-16-4-2-1-3-5-16/h6-9,16,19H,1-5,10-15H2 |
| InChIKey | OJVWKPFLOVKBMD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |