C16H20FN3O — CID 131950223
4-(4-fluorophenoxy)-1-[2-(1H-imidazol-2-yl)ethyl]piperidine (PubChem CID 131950223) has the molecular formula C16H20FN3O and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-1-[2-(1H-imidazol-2-yl)ethyl]piperidine.
| Compound Name | 4-(4-fluorophenoxy)-1-[2-(1H-imidazol-2-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 131950223 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 4-(4-fluorophenoxy)-1-[2-(1H-imidazol-2-yl)ethyl]piperidine |
| SMILES | Fc1ccc(OC2CCN(CCc3ncc[nH]3)CC2)cc1 |
| InChI | InChI=1S/C16H20FN3O/c17-13-1-3-14(4-2-13)21-15-5-10-20(11-6-15)12-7-16-18-8-9-19-16/h1-4,8-9,15H,5-7,10-12H2,(H,18,19) |
| InChIKey | BMCDYFRXQWALSS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |