C11H19N3O2 — CID 157155381
formic acid;1-[2-(1H-imidazol-2-yl)ethyl]piperidine (PubChem CID 157155381) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is formic acid;1-[2-(1H-imidazol-2-yl)ethyl]piperidine.
| Compound Name | formic acid;1-[2-(1H-imidazol-2-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 157155381 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | formic acid;1-[2-(1H-imidazol-2-yl)ethyl]piperidine |
| SMILES | O=CO.c1c[nH]c(CCN2CCCCC2)n1 |
| InChI | InChI=1S/C10H17N3.CH2O2/c1-2-7-13(8-3-1)9-4-10-11-5-6-12-10;2-1-3/h5-6H,1-4,7-9H2,(H,11,12);1H,(H,2,3) |
| InChIKey | ALSZTEULUMNZOG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|