C10H16N4O — CID 115608297
2-(1H-imidazol-2-ylmethylamino)-1-pyrrolidin-1-ylethanone (PubChem CID 115608297) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(1H-imidazol-2-ylmethylamino)-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-(1H-imidazol-2-ylmethylamino)-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 115608297 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-(1H-imidazol-2-ylmethylamino)-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CNCc1ncc[nH]1)N1CCCC1 |
| InChI | InChI=1S/C10H16N4O/c15-10(14-5-1-2-6-14)8-11-7-9-12-3-4-13-9/h3-4,11H,1-2,5-8H2,(H,12,13) |
| InChIKey | UFAGREDLQGONKS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |