C11H17N3OS — CID 115590354
1-piperidin-1-yl-2-(1,3-thiazol-4-ylmethylamino)ethanone (PubChem CID 115590354) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 1-piperidin-1-yl-2-(1,3-thiazol-4-ylmethylamino)ethanone.
| Compound Name | 1-piperidin-1-yl-2-(1,3-thiazol-4-ylmethylamino)ethanone |
|---|---|
| PubChem CID | 115590354 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-piperidin-1-yl-2-(1,3-thiazol-4-ylmethylamino)ethanone |
| SMILES | O=C(CNCc1cscn1)N1CCCCC1 |
| InChI | InChI=1S/C11H17N3OS/c15-11(14-4-2-1-3-5-14)7-12-6-10-8-16-9-13-10/h8-9,12H,1-7H2 |
| InChIKey | OTGCWOGGFSBDNT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |