C25H24F3NO — CID 97356612
4-phenoxy-1-[(R)-phenyl-[3-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 97356612) has the molecular formula C25H24F3NO and a molecular weight of 411.47 g/mol. Its IUPAC name is 4-phenoxy-1-[(R)-phenyl-[3-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 4-phenoxy-1-[(R)-phenyl-[3-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 97356612 |
| Molecular Formula | C25H24F3NO |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4-phenoxy-1-[(R)-phenyl-[3-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | FC(F)(F)c1cccc([C@@H](c2ccccc2)N2CCC(Oc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C25H24F3NO/c26-25(27,28)21-11-7-10-20(18-21)24(19-8-3-1-4-9-19)29-16-14-23(15-17-29)30-22-12-5-2-6-13-22/h1-13,18,23-24H,14-17H2/t24-/m1/s1 |
| InChIKey | ZYIUEDKQQGSDGP-XMMPIXPASA-N |
| XLogP | 6.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |