C18H17F3INO — CID 70402426
1-[iodo(phenyl)methyl]-3-[3-(trifluoromethyl)phenoxy]pyrrolidine (PubChem CID 70402426) has the molecular formula C18H17F3INO and a molecular weight of 447.24 g/mol. Its IUPAC name is 1-[iodo(phenyl)methyl]-3-[3-(trifluoromethyl)phenoxy]pyrrolidine.
| Compound Name | 1-[iodo(phenyl)methyl]-3-[3-(trifluoromethyl)phenoxy]pyrrolidine |
|---|---|
| PubChem CID | 70402426 |
| Molecular Formula | C18H17F3INO |
| Molecular Weight | 447.24 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 1-[iodo(phenyl)methyl]-3-[3-(trifluoromethyl)phenoxy]pyrrolidine |
| SMILES | FC(F)(F)c1cccc(OC2CCN(C(I)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C18H17F3INO/c19-18(20,21)14-7-4-8-15(11-14)24-16-9-10-23(12-16)17(22)13-5-2-1-3-6-13/h1-8,11,16-17H,9-10,12H2 |
| InChIKey | PCDZKWQQAHWZRD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.24 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|