C15H19F3N2 — CID 117269449
1-[2-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enyl]piperazine (PubChem CID 117269449) has the molecular formula C15H19F3N2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 1-[2-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enyl]piperazine.
| Compound Name | 1-[2-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enyl]piperazine |
|---|---|
| PubChem CID | 117269449 |
| Molecular Formula | C15H19F3N2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-[2-[[3-(trifluoromethyl)phenyl]methyl]prop-2-enyl]piperazine |
| SMILES | C=C(Cc1cccc(C(F)(F)F)c1)CN1CCNCC1 |
| InChI | InChI=1S/C15H19F3N2/c1-12(11-20-7-5-19-6-8-20)9-13-3-2-4-14(10-13)15(16,17)18/h2-4,10,19H,1,5-9,11H2 |
| InChIKey | ISEAIXVUANYLEE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|