C20H20Cl2F3N3O — CID 162364737
3,4-dichloro-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]benzamide (PubChem CID 162364737) has the molecular formula C20H20Cl2F3N3O and a molecular weight of 446.30 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 162364737 |
| Molecular Formula | C20H20Cl2F3N3O |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 3,4-dichloro-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]benzamide |
| SMILES | O=C(NCCN1CCN(c2cccc(C(F)(F)F)c2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2F3N3O/c21-17-5-4-14(12-18(17)22)19(29)26-6-7-27-8-10-28(11-9-27)16-3-1-2-15(13-16)20(23,24)25/h1-5,12-13H,6-11H2,(H,26,29) |
| InChIKey | SUZXVAHLHWMSBE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |