C23H29F3N4OS — CID 60502123
2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]acetamide (PubChem CID 60502123) has the molecular formula C23H29F3N4OS and a molecular weight of 466.57 g/mol. Its IUPAC name is 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]acetamide.
| Compound Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 60502123 |
| Molecular Formula | C23H29F3N4OS |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]acetamide |
| SMILES | O=C(CN1CCc2sccc2C1)NCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H29F3N4OS/c24-23(25,26)19-3-1-4-20(15-19)30-12-10-28(11-13-30)8-2-7-27-22(31)17-29-9-5-21-18(16-29)6-14-32-21/h1,3-4,6,14-15H,2,5,7-13,16-17H2,(H,27,31) |
| InChIKey | RZEVDZYOXFHJGI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|