C24H26ClN5O2 — CID 56503147
N-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide (PubChem CID 56503147) has the molecular formula C24H26ClN5O2 and a molecular weight of 451.96 g/mol. Its IUPAC name is N-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide.
| Compound Name | N-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 56503147 |
| Molecular Formula | C24H26ClN5O2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(=O)N2CCN(c3cccc(Cl)c3)CC2)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C24H26ClN5O2/c1-17-14-21(18(2)30(17)22-8-3-4-9-26-22)24(32)27-16-23(31)29-12-10-28(11-13-29)20-7-5-6-19(25)15-20/h3-9,14-15H,10-13,16H2,1-2H3,(H,27,32) |
| InChIKey | HLGJNPDDHIRBGX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|