C22H20ClN3O2 — CID 86951090
(E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-N-(4-hydroxy-2,3-dihydro-1H-inden-1-yl)prop-2-enamide (PubChem CID 86951090) has the molecular formula C22H20ClN3O2 and a molecular weight of 393.87 g/mol. Its IUPAC name is (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-N-(4-hydroxy-2,3-dihydro-1H-inden-1-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-N-(4-hydroxy-2,3-dihydro-1H-inden-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 86951090 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-N-(4-hydroxy-2,3-dihydro-1H-inden-1-yl)prop-2-enamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=C/C(=O)NC1CCc2c(O)cccc21 |
| InChI | InChI=1S/C22H20ClN3O2/c1-14-16(22(23)26(25-14)15-6-3-2-4-7-15)11-13-21(28)24-19-12-10-18-17(19)8-5-9-20(18)27/h2-9,11,13,19,27H,10,12H2,1H3,(H,24,28)/b13-11+ |
| InChIKey | MJEMQKOYPLTMOR-ACCUITESSA-N |
| XLogP | 4.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|