C22H19ClN2O4 — CID 7583271
[2-(4-methoxyphenyl)-2-oxoethyl] (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)prop-2-enoate (PubChem CID 7583271) has the molecular formula C22H19ClN2O4 and a molecular weight of 410.86 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7583271 |
| Molecular Formula | C22H19ClN2O4 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)prop-2-enoate |
| SMILES | COc1ccc(C(=O)COC(=O)/C=C/c2c(C)nn(-c3ccccc3)c2Cl)cc1 |
| InChI | InChI=1S/C22H19ClN2O4/c1-15-19(22(23)25(24-15)17-6-4-3-5-7-17)12-13-21(27)29-14-20(26)16-8-10-18(28-2)11-9-16/h3-13H,14H2,1-2H3/b13-12+ |
| InChIKey | JHBZJDOAXIZVAI-OUKQBFOZSA-N |
| XLogP | 4.28 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|