C17H16N4O3 — CID 5344948
4-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethenyl]-3-methyl-5-nitro-1,2-oxazole (PubChem CID 5344948) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethenyl]-3-methyl-5-nitro-1,2-oxazole.
| Compound Name | 4-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethenyl]-3-methyl-5-nitro-1,2-oxazole |
|---|---|
| PubChem CID | 5344948 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethenyl]-3-methyl-5-nitro-1,2-oxazole |
| SMILES | Cc1noc([N+](=O)[O-])c1C=Cc1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C17H16N4O3/c1-11-15(9-10-16-12(2)19-24-17(16)21(22)23)13(3)20(18-11)14-7-5-4-6-8-14/h4-10H,1-3H3 |
| InChIKey | FYCDWZCJJBVSQK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 86.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|