C12H14O2S2 — CID 139841368
1,3-bis(prop-1-enylsulfinyl)benzene (PubChem CID 139841368) has the molecular formula C12H14O2S2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 1,3-bis(prop-1-enylsulfinyl)benzene.
| Compound Name | 1,3-bis(prop-1-enylsulfinyl)benzene |
|---|---|
| PubChem CID | 139841368 |
| Molecular Formula | C12H14O2S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 1,3-bis(prop-1-enylsulfinyl)benzene |
| SMILES | CC=CS(=O)c1cccc(S(=O)C=CC)c1 |
| InChI | InChI=1S/C12H14O2S2/c1-3-8-15(13)11-6-5-7-12(10-11)16(14)9-4-2/h3-10H,1-2H3 |
| InChIKey | QXLVWYHGCHLUHE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |