C25H18F3N3O2S — CID 68507813
(E)-N-methyl-N-(quinoxalin-6-ylmethyl)-3-[4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]phenyl]prop-2-enamide (PubChem CID 68507813) has the molecular formula C25H18F3N3O2S and a molecular weight of 481.50 g/mol. Its IUPAC name is (E)-N-methyl-N-(quinoxalin-6-ylmethyl)-3-[4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-methyl-N-(quinoxalin-6-ylmethyl)-3-[4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 68507813 |
| Molecular Formula | C25H18F3N3O2S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | (E)-N-methyl-N-(quinoxalin-6-ylmethyl)-3-[4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]phenyl]prop-2-enamide |
| SMILES | CN(Cc1ccc2nccnc2c1)C(=O)/C=C/c1ccc(-c2ccc(C(=O)C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C25H18F3N3O2S/c1-31(15-17-4-8-19-20(14-17)30-13-12-29-19)23(32)11-5-16-2-6-18(7-3-16)21-9-10-22(34-21)24(33)25(26,27)28/h2-14H,15H2,1H3/b11-5+ |
| InChIKey | DIOMEHVANCOZMS-VZUCSPMQSA-N |
| XLogP | 5.78 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|