C14H17F3INO — CID 56531059
N-(2,2-dimethylpropyl)-3-iodo-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 56531059) has the molecular formula C14H17F3INO and a molecular weight of 399.19 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-3-iodo-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-(2,2-dimethylpropyl)-3-iodo-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 56531059 |
| Molecular Formula | C14H17F3INO |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | N-(2,2-dimethylpropyl)-3-iodo-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC(C)(C)CN(CC(F)(F)F)C(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C14H17F3INO/c1-13(2,3)8-19(9-14(15,16)17)12(20)10-5-4-6-11(18)7-10/h4-7H,8-9H2,1-3H3 |
| InChIKey | RVDDUCFREWXSME-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|