C17H26INO — CID 60653047
3-iodo-N,N-bis(3-methylbutyl)benzamide (PubChem CID 60653047) has the molecular formula C17H26INO and a molecular weight of 387.31 g/mol. Its IUPAC name is 3-iodo-N,N-bis(3-methylbutyl)benzamide.
| Compound Name | 3-iodo-N,N-bis(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 60653047 |
| Molecular Formula | C17H26INO |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-iodo-N,N-bis(3-methylbutyl)benzamide |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C17H26INO/c1-13(2)8-10-19(11-9-14(3)4)17(20)15-6-5-7-16(18)12-15/h5-7,12-14H,8-11H2,1-4H3 |
| InChIKey | SHQNDXWROWFKBS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|