C14H20IN3O2 — CID 76917368
N-(3-amino-3-hydroxyiminopropyl)-3-iodo-N-(2-methylpropyl)benzamide (PubChem CID 76917368) has the molecular formula C14H20IN3O2 and a molecular weight of 389.24 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-3-iodo-N-(2-methylpropyl)benzamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-3-iodo-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 76917368 |
| Molecular Formula | C14H20IN3O2 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-3-iodo-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(CCC(N)=NO)C(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C14H20IN3O2/c1-10(2)9-18(7-6-13(16)17-20)14(19)11-4-3-5-12(15)8-11/h3-5,8,10,20H,6-7,9H2,1-2H3,(H2,16,17) |
| InChIKey | MVCYRSCRBXDEOE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|