C14H19BrFN3O2 — CID 76914023
N-(3-amino-3-hydroxyiminopropyl)-4-bromo-3-fluoro-N-(2-methylpropyl)benzamide (PubChem CID 76914023) has the molecular formula C14H19BrFN3O2 and a molecular weight of 360.23 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-4-bromo-3-fluoro-N-(2-methylpropyl)benzamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-4-bromo-3-fluoro-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 76914023 |
| Molecular Formula | C14H19BrFN3O2 |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-4-bromo-3-fluoro-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(CCC(N)=NO)C(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C14H19BrFN3O2/c1-9(2)8-19(6-5-13(17)18-21)14(20)10-3-4-11(15)12(16)7-10/h3-4,7,9,21H,5-6,8H2,1-2H3,(H2,17,18) |
| InChIKey | HRIDZEIJJPKPCV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|