C10H17N5O2S — CID 77060547
N-(3-amino-3-hydroxyiminopropyl)-N-(2-methylpropyl)thiadiazole-4-carboxamide (PubChem CID 77060547) has the molecular formula C10H17N5O2S and a molecular weight of 271.35 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-N-(2-methylpropyl)thiadiazole-4-carboxamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-N-(2-methylpropyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 77060547 |
| Molecular Formula | C10H17N5O2S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-N-(2-methylpropyl)thiadiazole-4-carboxamide |
| SMILES | CC(C)CN(CCC(N)=NO)C(=O)c1csnn1 |
| InChI | InChI=1S/C10H17N5O2S/c1-7(2)5-15(4-3-9(11)13-17)10(16)8-6-18-14-12-8/h6-7,17H,3-5H2,1-2H3,(H2,11,13) |
| InChIKey | YCRWJNLGOMXTLR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|