C7H11N3OS — CID 60757863
N,N-diethylthiadiazole-4-carboxamide (PubChem CID 60757863) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is N,N-diethylthiadiazole-4-carboxamide.
| Compound Name | N,N-diethylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 60757863 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | N,N-diethylthiadiazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1csnn1 |
| InChI | InChI=1S/C7H11N3OS/c1-3-10(4-2)7(11)6-5-12-9-8-6/h5H,3-4H2,1-2H3 |
| InChIKey | HUQIPPRWVDMTRD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |