C9H11N3O3S — CID 65214654
2-[cyclopropylmethyl(thiadiazole-4-carbonyl)amino]acetic acid (PubChem CID 65214654) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-[cyclopropylmethyl(thiadiazole-4-carbonyl)amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl(thiadiazole-4-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 65214654 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-[cyclopropylmethyl(thiadiazole-4-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC1CC1)C(=O)c1csnn1 |
| InChI | InChI=1S/C9H11N3O3S/c13-8(14)4-12(3-6-1-2-6)9(15)7-5-16-11-10-7/h5-6H,1-4H2,(H,13,14) |
| InChIKey | ZXMJBVVMUTWBSO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |