C10H13N3O3S — CID 43655872
2-[cyclopropylmethyl-(4-methylthiadiazole-5-carbonyl)amino]acetic acid (PubChem CID 43655872) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-(4-methylthiadiazole-5-carbonyl)amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-(4-methylthiadiazole-5-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 43655872 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-[cyclopropylmethyl-(4-methylthiadiazole-5-carbonyl)amino]acetic acid |
| SMILES | Cc1nnsc1C(=O)N(CC(=O)O)CC1CC1 |
| InChI | InChI=1S/C10H13N3O3S/c1-6-9(17-12-11-6)10(16)13(5-8(14)15)4-7-2-3-7/h7H,2-5H2,1H3,(H,14,15) |
| InChIKey | RWSFDEPLRXHFBP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |