C16H17NO3S — CID 43655509
2-[cyclopropylmethyl-(3-methyl-1-benzothiophene-2-carbonyl)amino]acetic acid (PubChem CID 43655509) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-(3-methyl-1-benzothiophene-2-carbonyl)amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-(3-methyl-1-benzothiophene-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 43655509 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-[cyclopropylmethyl-(3-methyl-1-benzothiophene-2-carbonyl)amino]acetic acid |
| SMILES | Cc1c(C(=O)N(CC(=O)O)CC2CC2)sc2ccccc12 |
| InChI | InChI=1S/C16H17NO3S/c1-10-12-4-2-3-5-13(12)21-15(10)16(20)17(9-14(18)19)8-11-6-7-11/h2-5,11H,6-9H2,1H3,(H,18,19) |
| InChIKey | INTARJDMTSDNGZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |