C7H11N3O3S — CID 65216327
N,N-bis(2-hydroxyethyl)thiadiazole-4-carboxamide (PubChem CID 65216327) has the molecular formula C7H11N3O3S and a molecular weight of 217.25 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)thiadiazole-4-carboxamide.
| Compound Name | N,N-bis(2-hydroxyethyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 65216327 |
| Molecular Formula | C7H11N3O3S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)thiadiazole-4-carboxamide |
| SMILES | O=C(c1csnn1)N(CCO)CCO |
| InChI | InChI=1S/C7H11N3O3S/c11-3-1-10(2-4-12)7(13)6-5-14-9-8-6/h5,11-12H,1-4H2 |
| InChIKey | OELGAMUPZPJHMF-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |