C6H8N4OS2 — CID 65216482
N-(2-amino-2-sulfanylideneethyl)-N-methylthiadiazole-4-carboxamide (PubChem CID 65216482) has the molecular formula C6H8N4OS2 and a molecular weight of 216.29 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N-methylthiadiazole-4-carboxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N-methylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 65216482 |
| Molecular Formula | C6H8N4OS2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N-methylthiadiazole-4-carboxamide |
| SMILES | CN(CC(N)=S)C(=O)c1csnn1 |
| InChI | InChI=1S/C6H8N4OS2/c1-10(2-5(7)12)6(11)4-3-13-9-8-4/h3H,2H2,1H3,(H2,7,12) |
| InChIKey | LRMGDRSJAGAGTP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|