C9H14N4OS2 — CID 65204972
N-(2-amino-2-sulfanylideneethyl)-N-methyl-4-propylthiadiazole-5-carboxamide (PubChem CID 65204972) has the molecular formula C9H14N4OS2 and a molecular weight of 258.37 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N-methyl-4-propylthiadiazole-5-carboxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N-methyl-4-propylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65204972 |
| Molecular Formula | C9H14N4OS2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N-methyl-4-propylthiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)N(C)CC(N)=S |
| InChI | InChI=1S/C9H14N4OS2/c1-3-4-6-8(16-12-11-6)9(14)13(2)5-7(10)15/h3-5H2,1-2H3,(H2,10,15) |
| InChIKey | XJGQHDZONQGDAY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|