C14H16BrN3OS — CID 65205282
N-[(3-bromophenyl)methyl]-N-methyl-4-propylthiadiazole-5-carboxamide (PubChem CID 65205282) has the molecular formula C14H16BrN3OS and a molecular weight of 354.27 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N-methyl-4-propylthiadiazole-5-carboxamide.
| Compound Name | N-[(3-bromophenyl)methyl]-N-methyl-4-propylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65205282 |
| Molecular Formula | C14H16BrN3OS |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N-methyl-4-propylthiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)N(C)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C14H16BrN3OS/c1-3-5-12-13(20-17-16-12)14(19)18(2)9-10-6-4-7-11(15)8-10/h4,6-8H,3,5,9H2,1-2H3 |
| InChIKey | WPXQPBCTWGGFPK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |