C9H14N4OS — CID 116652070
N-(2-amino-1-cyclopropylethyl)-N-methylthiadiazole-4-carboxamide (PubChem CID 116652070) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-N-methylthiadiazole-4-carboxamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-N-methylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 116652070 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-N-methylthiadiazole-4-carboxamide |
| SMILES | CN(C(=O)c1csnn1)C(CN)C1CC1 |
| InChI | InChI=1S/C9H14N4OS/c1-13(8(4-10)6-2-3-6)9(14)7-5-15-12-11-7/h5-6,8H,2-4,10H2,1H3 |
| InChIKey | OMDFZNJCSHOAQU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |