About N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide
N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide (PubChem CID 116652032) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide |
| PubChem CID | 116652032 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide |
| SMILES | Cc1c(O)cccc1C(=O)N(C)C(CN)C1CC1 |
| InChI | InChI=1S/C14H20N2O2/c1-9-11(4-3-5-13(9)17)14(18)16(2)12(8-15)10-6-7-10/h3-5,10,12,17H,6-8,15H2,1-2H3 |
| InChIKey | XKWGNCUTVKMCAQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide?
The IUPAC name of N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide (CID 116652032) is N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide.
What is the SMILES notation for N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide?
The canonical SMILES for N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide is Cc1c(O)cccc1C(=O)N(C)C(CN)C1CC1.
What is the InChIKey of N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide?
The InChIKey is XKWGNCUTVKMCAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c1-9-11(4-3-5-13(9)17)14(18)16(2)12(8-15)10-6-7-10/h3-5,10,12,17H,6-8,15H2,1-2H3.
What are the key properties of N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide?
N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide has a molecular weight of 248.33 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-1-cyclopropylethyl)-3-hydroxy-N,2-dimethylbenzamide is sourced from PubChem (CID 116652032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).