C14H21N3O — CID 107654315
1-(2-amino-1-cyclopropylethyl)-3-benzyl-1-methylurea (PubChem CID 107654315) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-(2-amino-1-cyclopropylethyl)-3-benzyl-1-methylurea.
| Compound Name | 1-(2-amino-1-cyclopropylethyl)-3-benzyl-1-methylurea |
|---|---|
| PubChem CID | 107654315 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-(2-amino-1-cyclopropylethyl)-3-benzyl-1-methylurea |
| SMILES | CN(C(=O)NCc1ccccc1)C(CN)C1CC1 |
| InChI | InChI=1S/C14H21N3O/c1-17(13(9-15)12-7-8-12)14(18)16-10-11-5-3-2-4-6-11/h2-6,12-13H,7-10,15H2,1H3,(H,16,18) |
| InChIKey | YEKXYPVOVGFBDP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |