C12H16IN3O2 — CID 54993141
N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-4-iodobenzamide (PubChem CID 54993141) has the molecular formula C12H16IN3O2 and a molecular weight of 361.18 g/mol. Its IUPAC name is N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-4-iodobenzamide.
| Compound Name | N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-4-iodobenzamide |
|---|---|
| PubChem CID | 54993141 |
| Molecular Formula | C12H16IN3O2 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | N-[(3Z)-3-amino-3-hydroxyiminopropyl]-N-ethyl-4-iodobenzamide |
| SMILES | CCN(CC/C(N)=N/O)C(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C12H16IN3O2/c1-2-16(8-7-11(14)15-18)12(17)9-3-5-10(13)6-4-9/h3-6,18H,2,7-8H2,1H3,(H2,14,15) |
| InChIKey | MNNSORZJMFOSQU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|