C13H15F3INO — CID 54938230
3-iodo-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 54938230) has the molecular formula C13H15F3INO and a molecular weight of 385.17 g/mol. Its IUPAC name is 3-iodo-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-iodo-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 54938230 |
| Molecular Formula | C13H15F3INO |
| Molecular Weight | 385.17 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 3-iodo-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC(C)CN(CC(F)(F)F)C(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C13H15F3INO/c1-9(2)7-18(8-13(14,15)16)12(19)10-4-3-5-11(17)6-10/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | OBIIUSLJXPCGTQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.17 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|