C19H28F3NO3 — CID 56531111
4-butoxy-N-(2,2-dimethylpropyl)-3-methoxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 56531111) has the molecular formula C19H28F3NO3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 4-butoxy-N-(2,2-dimethylpropyl)-3-methoxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-butoxy-N-(2,2-dimethylpropyl)-3-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 56531111 |
| Molecular Formula | C19H28F3NO3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 4-butoxy-N-(2,2-dimethylpropyl)-3-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CC(C)(C)C)CC(F)(F)F)cc1OC |
| InChI | InChI=1S/C19H28F3NO3/c1-6-7-10-26-15-9-8-14(11-16(15)25-5)17(24)23(12-18(2,3)4)13-19(20,21)22/h8-9,11H,6-7,10,12-13H2,1-5H3 |
| InChIKey | WJNHEXOSUPAEFD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|