C15H18F3NO3 — CID 51094536
4-ethoxy-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 51094536) has the molecular formula C15H18F3NO3 and a molecular weight of 317.31 g/mol. Its IUPAC name is 4-ethoxy-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-ethoxy-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 51094536 |
| Molecular Formula | C15H18F3NO3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 4-ethoxy-3-methoxy-N-prop-2-enyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | C=CCN(CC(F)(F)F)C(=O)c1ccc(OCC)c(OC)c1 |
| InChI | InChI=1S/C15H18F3NO3/c1-4-8-19(10-15(16,17)18)14(20)11-6-7-12(22-5-2)13(9-11)21-3/h4,6-7,9H,1,5,8,10H2,2-3H3 |
| InChIKey | VUEVYXFFXNUUMB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|