C15H11IO4 — CID 169097531
1-(2,6-dihydroxyphenyl)-3-(3-iodophenyl)propane-1,3-dione (PubChem CID 169097531) has the molecular formula C15H11IO4 and a molecular weight of 382.15 g/mol. Its IUPAC name is 1-(2,6-dihydroxyphenyl)-3-(3-iodophenyl)propane-1,3-dione.
| Compound Name | 1-(2,6-dihydroxyphenyl)-3-(3-iodophenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 169097531 |
| Molecular Formula | C15H11IO4 |
| Molecular Weight | 382.15 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 1-(2,6-dihydroxyphenyl)-3-(3-iodophenyl)propane-1,3-dione |
| SMILES | O=C(CC(=O)c1c(O)cccc1O)c1cccc(I)c1 |
| InChI | InChI=1S/C15H11IO4/c16-10-4-1-3-9(7-10)13(19)8-14(20)15-11(17)5-2-6-12(15)18/h1-7,17-18H,8H2 |
| InChIKey | XNBIJNJPSYIWQH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.15 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|