C12H13F2NO5 — CID 107832660
4-[[3-(difluoromethoxy)benzoyl]amino]-2-hydroxybutanoic acid (PubChem CID 107832660) has the molecular formula C12H13F2NO5 and a molecular weight of 289.23 g/mol. Its IUPAC name is 4-[[3-(difluoromethoxy)benzoyl]amino]-2-hydroxybutanoic acid.
| Compound Name | 4-[[3-(difluoromethoxy)benzoyl]amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107832660 |
| Molecular Formula | C12H13F2NO5 |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 4-[[3-(difluoromethoxy)benzoyl]amino]-2-hydroxybutanoic acid |
| SMILES | O=C(NCCC(O)C(=O)O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C12H13F2NO5/c13-12(14)20-8-3-1-2-7(6-8)10(17)15-5-4-9(16)11(18)19/h1-3,6,9,12,16H,4-5H2,(H,15,17)(H,18,19) |
| InChIKey | PLYSVZFGMZLIRJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |