C14H16F3N3O3 — CID 91393192
N-[2-[(1-amino-1-oxobutan-2-yl)amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 91393192) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is N-[2-[(1-amino-1-oxobutan-2-yl)amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(1-amino-1-oxobutan-2-yl)amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91393192 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[2-[(1-amino-1-oxobutan-2-yl)amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | CCC(NC(=O)CNC(=O)c1cccc(C(F)(F)F)c1)C(N)=O |
| InChI | InChI=1S/C14H16F3N3O3/c1-2-10(12(18)22)20-11(21)7-19-13(23)8-4-3-5-9(6-8)14(15,16)17/h3-6,10H,2,7H2,1H3,(H2,18,22)(H,19,23)(H,20,21) |
| InChIKey | QELOLNOICNGTID-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |