C18H31N3O4 — CID 162429349
ethane;methyl 2-[[3-(carbamoylamino)benzoyl]amino]-3-methylbutanoate (PubChem CID 162429349) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is ethane;methyl 2-[[3-(carbamoylamino)benzoyl]amino]-3-methylbutanoate.
| Compound Name | ethane;methyl 2-[[3-(carbamoylamino)benzoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 162429349 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | ethane;methyl 2-[[3-(carbamoylamino)benzoyl]amino]-3-methylbutanoate |
| SMILES | CC.CC.COC(=O)C(NC(=O)c1cccc(NC(N)=O)c1)C(C)C |
| InChI | InChI=1S/C14H19N3O4.2C2H6/c1-8(2)11(13(19)21-3)17-12(18)9-5-4-6-10(7-9)16-14(15)20;2*1-2/h4-8,11H,1-3H3,(H,17,18)(H3,15,16,20);2*1-2H3 |
| InChIKey | WBYIERBKWUYVFU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |