C19H20N3O4+ — CID 7407855
(3S)-3-[(3,4-dimethoxybenzoyl)amino]-2-hydroxy-4-phenylbut-1-ene-1-diazonium (PubChem CID 7407855) has the molecular formula C19H20N3O4+ and a molecular weight of 354.39 g/mol. Its IUPAC name is (3S)-3-[(3,4-dimethoxybenzoyl)amino]-2-hydroxy-4-phenylbut-1-ene-1-diazonium.
| Compound Name | (3S)-3-[(3,4-dimethoxybenzoyl)amino]-2-hydroxy-4-phenylbut-1-ene-1-diazonium |
|---|---|
| PubChem CID | 7407855 |
| Molecular Formula | C19H20N3O4+ |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (3S)-3-[(3,4-dimethoxybenzoyl)amino]-2-hydroxy-4-phenylbut-1-ene-1-diazonium |
| SMILES | COc1ccc(C(=O)N[C@@H](Cc2ccccc2)C(O)=C[N+]#N)cc1OC |
| InChI | InChI=1S/C19H19N3O4/c1-25-17-9-8-14(11-18(17)26-2)19(24)22-15(16(23)12-21-20)10-13-6-4-3-5-7-13/h3-9,11-12,15H,10H2,1-2H3,(H-,22,23,24)/p+1/t15-/m0/s1 |
| InChIKey | RLLXQPFAIRZAQX-HNNXBMFYSA-O |
| XLogP | 3.30 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|