C20H16ClFN4S2 — CID 134602131
N-[5-chloro-2-fluoro-4-(1-isoquinolin-8-ylethylamino)phenyl]sulfanyl-1,3-thiazol-4-amine (PubChem CID 134602131) has the molecular formula C20H16ClFN4S2 and a molecular weight of 430.96 g/mol. Its IUPAC name is N-[5-chloro-2-fluoro-4-(1-isoquinolin-8-ylethylamino)phenyl]sulfanyl-1,3-thiazol-4-amine.
| Compound Name | N-[5-chloro-2-fluoro-4-(1-isoquinolin-8-ylethylamino)phenyl]sulfanyl-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 134602131 |
| Molecular Formula | C20H16ClFN4S2 |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-[5-chloro-2-fluoro-4-(1-isoquinolin-8-ylethylamino)phenyl]sulfanyl-1,3-thiazol-4-amine |
| SMILES | CC(Nc1cc(F)c(SNc2cscn2)cc1Cl)c1cccc2ccncc12 |
| InChI | InChI=1S/C20H16ClFN4S2/c1-12(14-4-2-3-13-5-6-23-9-15(13)14)25-18-8-17(22)19(7-16(18)21)28-26-20-10-27-11-24-20/h2-12,25-26H,1H3 |
| InChIKey | LACAVWMGCZMQOH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|