C22H23ClF2N4S2 — CID 134602456
N-[5-chloro-2-fluoro-4-[[2-fluoro-5-(piperidin-1-ylmethyl)phenyl]methylamino]phenyl]sulfanyl-1,3-thiazol-4-amine (PubChem CID 134602456) has the molecular formula C22H23ClF2N4S2 and a molecular weight of 481.04 g/mol. Its IUPAC name is N-[5-chloro-2-fluoro-4-[[2-fluoro-5-(piperidin-1-ylmethyl)phenyl]methylamino]phenyl]sulfanyl-1,3-thiazol-4-amine.
| Compound Name | N-[5-chloro-2-fluoro-4-[[2-fluoro-5-(piperidin-1-ylmethyl)phenyl]methylamino]phenyl]sulfanyl-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 134602456 |
| Molecular Formula | C22H23ClF2N4S2 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-[5-chloro-2-fluoro-4-[[2-fluoro-5-(piperidin-1-ylmethyl)phenyl]methylamino]phenyl]sulfanyl-1,3-thiazol-4-amine |
| SMILES | Fc1ccc(CN2CCCCC2)cc1CNc1cc(F)c(SNc2cscn2)cc1Cl |
| InChI | InChI=1S/C22H23ClF2N4S2/c23-17-9-21(31-28-22-13-30-14-27-22)19(25)10-20(17)26-11-16-8-15(4-5-18(16)24)12-29-6-2-1-3-7-29/h4-5,8-10,13-14,26,28H,1-3,6-7,11-12H2 |
| InChIKey | SWKYQSAHEKFRMB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|