C23H24F2N4S2 — CID 134602540
N-[4-[[2-(azetidin-1-ylmethyl)-6-cyclopropylphenyl]methylamino]-2,6-difluorophenyl]sulfanyl-1,3-thiazol-4-amine (PubChem CID 134602540) has the molecular formula C23H24F2N4S2 and a molecular weight of 458.60 g/mol. Its IUPAC name is N-[4-[[2-(azetidin-1-ylmethyl)-6-cyclopropylphenyl]methylamino]-2,6-difluorophenyl]sulfanyl-1,3-thiazol-4-amine.
| Compound Name | N-[4-[[2-(azetidin-1-ylmethyl)-6-cyclopropylphenyl]methylamino]-2,6-difluorophenyl]sulfanyl-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 134602540 |
| Molecular Formula | C23H24F2N4S2 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N-[4-[[2-(azetidin-1-ylmethyl)-6-cyclopropylphenyl]methylamino]-2,6-difluorophenyl]sulfanyl-1,3-thiazol-4-amine |
| SMILES | Fc1cc(NCc2c(CN3CCC3)cccc2C2CC2)cc(F)c1SNc1cscn1 |
| InChI | InChI=1S/C23H24F2N4S2/c24-20-9-17(10-21(25)23(20)31-28-22-13-30-14-27-22)26-11-19-16(12-29-7-2-8-29)3-1-4-18(19)15-5-6-15/h1,3-4,9-10,13-15,26,28H,2,5-8,11-12H2 |
| InChIKey | JBMHBHIDIKLQDE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|