C21H20F3N5S — CID 134601919
N-[4-[[2-(azetidin-1-ylmethyl)-6-fluorophenyl]methylamino]-2,6-difluorophenyl]sulfanylpyrimidin-2-amine (PubChem CID 134601919) has the molecular formula C21H20F3N5S and a molecular weight of 431.49 g/mol. Its IUPAC name is N-[4-[[2-(azetidin-1-ylmethyl)-6-fluorophenyl]methylamino]-2,6-difluorophenyl]sulfanylpyrimidin-2-amine.
| Compound Name | N-[4-[[2-(azetidin-1-ylmethyl)-6-fluorophenyl]methylamino]-2,6-difluorophenyl]sulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 134601919 |
| Molecular Formula | C21H20F3N5S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[4-[[2-(azetidin-1-ylmethyl)-6-fluorophenyl]methylamino]-2,6-difluorophenyl]sulfanylpyrimidin-2-amine |
| SMILES | Fc1cccc(CN2CCC2)c1CNc1cc(F)c(SNc2ncccn2)c(F)c1 |
| InChI | InChI=1S/C21H20F3N5S/c22-17-5-1-4-14(13-29-8-3-9-29)16(17)12-27-15-10-18(23)20(19(24)11-15)30-28-21-25-6-2-7-26-21/h1-2,4-7,10-11,27H,3,8-9,12-13H2,(H,25,26,28) |
| InChIKey | UUVBPTCSNFAXKZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|