C23H21F4N3O2S — CID 158531053
N-[[2-(azetidin-1-ylmethyl)-6-fluorophenyl]methyl]-3,5-difluoro-4-[(6-fluoro-2-pyridinyl)methylsulfonyl]aniline (PubChem CID 158531053) has the molecular formula C23H21F4N3O2S and a molecular weight of 479.50 g/mol. Its IUPAC name is N-[[2-(azetidin-1-ylmethyl)-6-fluorophenyl]methyl]-3,5-difluoro-4-[(6-fluoro-2-pyridinyl)methylsulfonyl]aniline.
| Compound Name | N-[[2-(azetidin-1-ylmethyl)-6-fluorophenyl]methyl]-3,5-difluoro-4-[(6-fluoro-2-pyridinyl)methylsulfonyl]aniline |
|---|---|
| PubChem CID | 158531053 |
| Molecular Formula | C23H21F4N3O2S |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N-[[2-(azetidin-1-ylmethyl)-6-fluorophenyl]methyl]-3,5-difluoro-4-[(6-fluoro-2-pyridinyl)methylsulfonyl]aniline |
| SMILES | O=S(=O)(Cc1cccc(F)n1)c1c(F)cc(NCc2c(F)cccc2CN2CCC2)cc1F |
| InChI | InChI=1S/C23H21F4N3O2S/c24-19-6-1-4-15(13-30-8-3-9-30)18(19)12-28-17-10-20(25)23(21(26)11-17)33(31,32)14-16-5-2-7-22(27)29-16/h1-2,4-7,10-11,28H,3,8-9,12-14H2 |
| InChIKey | SEFLVBHHQXYOFI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|