C23H24F3N5O4S2 — CID 134586095
[[2,6-difluoro-4-[[2-fluoro-6-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]phenyl]sulfonyl-(1,3-thiazol-4-yl)amino] formate (PubChem CID 134586095) has the molecular formula C23H24F3N5O4S2 and a molecular weight of 555.60 g/mol. Its IUPAC name is [[2,6-difluoro-4-[[2-fluoro-6-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]phenyl]sulfonyl-(1,3-thiazol-4-yl)amino] formate.
| Compound Name | [[2,6-difluoro-4-[[2-fluoro-6-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]phenyl]sulfonyl-(1,3-thiazol-4-yl)amino] formate |
|---|---|
| PubChem CID | 134586095 |
| Molecular Formula | C23H24F3N5O4S2 |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | [[2,6-difluoro-4-[[2-fluoro-6-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]phenyl]sulfonyl-(1,3-thiazol-4-yl)amino] formate |
| SMILES | CN1CCN(Cc2cccc(F)c2CNc2cc(F)c(S(=O)(=O)N(OC=O)c3cscn3)c(F)c2)CC1 |
| InChI | InChI=1S/C23H24F3N5O4S2/c1-29-5-7-30(8-6-29)12-16-3-2-4-19(24)18(16)11-27-17-9-20(25)23(21(26)10-17)37(33,34)31(35-15-32)22-13-36-14-28-22/h2-4,9-10,13-15,27H,5-8,11-12H2,1H3 |
| InChIKey | OXSOIIUAOJVWHW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|