C21H18ClF3N4O4S2 — CID 134585926
[[4-[[2-(azetidin-1-ylmethyl)-4,5-difluorophenyl]methylamino]-5-chloro-2-fluorophenyl]sulfonyl-(1,3-thiazol-4-yl)amino] formate (PubChem CID 134585926) has the molecular formula C21H18ClF3N4O4S2 and a molecular weight of 546.98 g/mol. Its IUPAC name is [[4-[[2-(azetidin-1-ylmethyl)-4,5-difluorophenyl]methylamino]-5-chloro-2-fluorophenyl]sulfonyl-(1,3-thiazol-4-yl)amino] formate.
| Compound Name | [[4-[[2-(azetidin-1-ylmethyl)-4,5-difluorophenyl]methylamino]-5-chloro-2-fluorophenyl]sulfonyl-(1,3-thiazol-4-yl)amino] formate |
|---|---|
| PubChem CID | 134585926 |
| Molecular Formula | C21H18ClF3N4O4S2 |
| Molecular Weight | 546.98 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | [[4-[[2-(azetidin-1-ylmethyl)-4,5-difluorophenyl]methylamino]-5-chloro-2-fluorophenyl]sulfonyl-(1,3-thiazol-4-yl)amino] formate |
| SMILES | O=CON(c1cscn1)S(=O)(=O)c1cc(Cl)c(NCc2cc(F)c(F)cc2CN2CCC2)cc1F |
| InChI | InChI=1S/C21H18ClF3N4O4S2/c22-15-6-20(35(31,32)29(33-12-30)21-10-34-11-27-21)18(25)7-19(15)26-8-13-4-16(23)17(24)5-14(13)9-28-2-1-3-28/h4-7,10-12,26H,1-3,8-9H2 |
| InChIKey | FJHTYMKTPRGMGT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.98 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|