C21H19F3N4O5S2 — CID 134585629
[[2,6-difluoro-4-[[2-fluoro-6-(1-methylazetidin-3-yl)oxyphenyl]methylamino]phenyl]sulfonyl-(1,3-thiazol-4-yl)amino] formate (PubChem CID 134585629) has the molecular formula C21H19F3N4O5S2 and a molecular weight of 528.53 g/mol. Its IUPAC name is [[2,6-difluoro-4-[[2-fluoro-6-(1-methylazetidin-3-yl)oxyphenyl]methylamino]phenyl]sulfonyl-(1,3-thiazol-4-yl)amino] formate.
| Compound Name | [[2,6-difluoro-4-[[2-fluoro-6-(1-methylazetidin-3-yl)oxyphenyl]methylamino]phenyl]sulfonyl-(1,3-thiazol-4-yl)amino] formate |
|---|---|
| PubChem CID | 134585629 |
| Molecular Formula | C21H19F3N4O5S2 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | [[2,6-difluoro-4-[[2-fluoro-6-(1-methylazetidin-3-yl)oxyphenyl]methylamino]phenyl]sulfonyl-(1,3-thiazol-4-yl)amino] formate |
| SMILES | CN1CC(Oc2cccc(F)c2CNc2cc(F)c(S(=O)(=O)N(OC=O)c3cscn3)c(F)c2)C1 |
| InChI | InChI=1S/C21H19F3N4O5S2/c1-27-8-14(9-27)33-19-4-2-3-16(22)15(19)7-25-13-5-17(23)21(18(24)6-13)35(30,31)28(32-12-29)20-10-34-11-26-20/h2-6,10-12,14,25H,7-9H2,1H3 |
| InChIKey | XGZJVHBNPTVXHO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|