C20H18ClF2N3O3S2 — CID 135160441
2-[3-[5-chloro-2-[2,5-difluoro-4-(1,3-thiazol-4-ylamino)sulfanylphenoxy]phenyl]propylamino]acetic acid (PubChem CID 135160441) has the molecular formula C20H18ClF2N3O3S2 and a molecular weight of 485.97 g/mol. Its IUPAC name is 2-[3-[5-chloro-2-[2,5-difluoro-4-(1,3-thiazol-4-ylamino)sulfanylphenoxy]phenyl]propylamino]acetic acid.
| Compound Name | 2-[3-[5-chloro-2-[2,5-difluoro-4-(1,3-thiazol-4-ylamino)sulfanylphenoxy]phenyl]propylamino]acetic acid |
|---|---|
| PubChem CID | 135160441 |
| Molecular Formula | C20H18ClF2N3O3S2 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 2-[3-[5-chloro-2-[2,5-difluoro-4-(1,3-thiazol-4-ylamino)sulfanylphenoxy]phenyl]propylamino]acetic acid |
| SMILES | O=C(O)CNCCCc1cc(Cl)ccc1Oc1cc(F)c(SNc2cscn2)cc1F |
| InChI | InChI=1S/C20H18ClF2N3O3S2/c21-13-3-4-16(12(6-13)2-1-5-24-9-20(27)28)29-17-7-15(23)18(8-14(17)22)31-26-19-10-30-11-25-19/h3-4,6-8,10-11,24,26H,1-2,5,9H2,(H,27,28) |
| InChIKey | LULIQBOZHWCYKO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|